Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:105588 term browser browse the term
Definition:A phthalimide that has formula C12H12N2O3.
Synonyms:related_synonym: Formula=C12H12N2O3;   InChI=1S/C12H12N2O3/c1-2-3-10(15)13-7-4-5-8-9(6-7)12(17)14-11(8)16/h4-6H,2-3H2,1H3,(H,13,15)(H,14,16,17);   InChIKey=HYNFGUHAYZBBCE-UHFFFAOYSA-N;   SMILES=CCCC(=O)NC1=CC2=C(C=C1)C(=O)NC2=O
 xref: LINCS:LSM-16951

GViewer not supported for chinchilla.
show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          nitrogen atom 0
            nitrogen molecular entity 0
              organonitrogen compound 0
                organonitrogen heterocyclic compound 0
                  benzopyrrole 0
                    isoindoles 0
                      phthalimides 0
                        N-(1,3-dioxo-5-isoindolyl)butanamide 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic molecule 0
                              organic cyclic compound 0
                                organic heterocyclic compound 0
                                  organic heteropolycyclic compound 0
                                    organic heterobicyclic compound 0
                                      benzopyrrole 0
                                        isoindoles 0
                                          phthalimides 0
                                            N-(1,3-dioxo-5-isoindolyl)butanamide 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.