Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:1-(3-nitrophenyl)-3-(3,4,5-trimethoxyphenyl)-2-propen-1-one
go back to main search page
Accession:CHEBI:112222 term browser browse the term
Definition:A chalcone that has formula C18H17NO6.
Synonyms:related_synonym: Formula=C18H17NO6;   InChI=1S/C18H17NO6/c1-23-16-9-12(10-17(24-2)18(16)25-3)7-8-15(20)13-5-4-6-14(11-13)19(21)22/h4-11H,1-3H3;   InChIKey=OYCXONLNNCKOQR-UHFFFAOYSA-N;   SMILES=COC1=CC(=CC(=C1OC)OC)C=CC(=O)C2=CC(=CC=C2)[N+](=O)[O-]
 xref: LINCS:LSM-23634


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          oxygen atom 0
            oxygen molecular entity 0
              flavonoids 0
                chalcones 0
                  1-(3-nitrophenyl)-3-(3,4,5-trimethoxyphenyl)-2-propen-1-one 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      ketone 0
                                        alpha,beta-unsaturated ketone 0
                                          enone 0
                                            chalcones 0
                                              1-(3-nitrophenyl)-3-(3,4,5-trimethoxyphenyl)-2-propen-1-one 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.