Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:2-(3,4-dimethoxyphenyl)-N-[3-(3-nitrophenyl)prop-2-enylideneamino]acetamide
go back to main search page
Accession:CHEBI:115707 term browser browse the term
Definition:A dimethoxybenzene that has formula C19H19N3O5.
Synonyms:related_synonym: Formula=C19H19N3O5;   InChI=1S/C19H19N3O5/c1-26-17-9-8-15(12-18(17)27-2)13-19(23)21-20-10-4-6-14-5-3-7-16(11-14)22(24)25/h3-12H,13H2,1-2H3,(H,21,23);   InChIKey=SBCWZYDVFQSFID-UHFFFAOYSA-N;   SMILES=COC1=C(C=C(C=C1)CC(=O)NN=CC=CC2=CC(=CC=C2)[N+](=O)[O-])OC
 xref: LINCS:LSM-27164


GViewer not supported for chinchilla.
show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          oxygen atom 0
            oxygen molecular entity 0
              organooxygen compound 0
                ether 0
                  aromatic ether 0
                    methoxybenzenes 0
                      dimethoxybenzene 0
                        2-(3,4-dimethoxyphenyl)-N-[3-(3-nitrophenyl)prop-2-enylideneamino]acetamide 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic molecule 0
                              organic cyclic compound 0
                                carbocyclic compound 0
                                  benzenoid aromatic compound 0
                                    benzenes 0
                                      methoxybenzenes 0
                                        dimethoxybenzene 0
                                          2-(3,4-dimethoxyphenyl)-N-[3-(3-nitrophenyl)prop-2-enylideneamino]acetamide 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.