Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


Term:flavodic acid
go back to main search page
Accession:CHEBI:135561 term browser browse the term
Synonyms:related_synonym: Formula=C19H14O8;   InChI=1S/C19H14O8/c20-13-8-14(11-4-2-1-3-5-11)27-16-7-12(25-9-17(21)22)6-15(19(13)16)26-10-18(23)24/h1-8H,9-10H2,(H,21,22)(H,23,24);   InChIKey=IGCSSLDDCHLXGL-UHFFFAOYSA-N;   SMILES=O(CC(O)=O)C1=C2C(OC(=CC2=O)C3=CC=CC=C3)=CC(=C1)OCC(O)=O;   flavodic acid sodium salt
 xref: CAS:37470-13-6 "DrugCentral";   Drug_Central:1173 "DrugCentral"

GViewer not supported for chinchilla.
show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          oxygen atom 0
            oxygen molecular entity 0
              flavonoids 0
                flavonoid 0
                  flavones 0
                    flavodic acid 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic molecule 0
                              organic cyclic compound 0
                                organic heterocyclic compound 0
                                  oxacycle 0
                                    benzopyran 0
                                      1-benzopyran 0
                                        flavonoid 0
                                          flavones 0
                                            flavodic acid 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.