Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


Term:sozoiodolic acid
go back to main search page
Accession:CHEBI:135689 term browser browse the term
Synonyms:related_synonym: Formula=C6H4I2O4S;   InChI=1S/C6H4I2O4S/c7-4-1-3(13(10,11)12)2-5(8)6(4)9/h1-2,9H,(H,10,11,12);   InChIKey=WUFWNWSUSBGBSH-UHFFFAOYSA-N;   SMILES=S(=O)(=O)(O)C1=CC(I)=C(C(=C1)I)O;   ronozol;   sozoiodol sodium;   sozoiodol zinc;   sozojodol
 xref: CAS:554-71-2 "DrugCentral";   Drug_Central:3830 "DrugCentral"

GViewer not supported for chinchilla.
show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          sulfur atom 0
            sulfur molecular entity 0
              organosulfur compound 0
                sozoiodolic acid 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      chalcogen 0
                        oxygen atom 0
                          oxygen molecular entity 0
                            hydroxides 0
                              oxoacid 0
                                chalcogen oxoacid 0
                                  sulfur oxoacid 0
                                    sulfonic acid 0
                                      sulfonic acid derivative 0
                                        sozoiodolic acid 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.