Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:acetic acid
go back to main search page
Accession:CHEBI:15366 term browser browse the term
Definition:A simple monocarboxylic acid containing two carbons.
Synonyms:related_synonym: AcOH;   CH3-COOH;   CH3CO2H;   E-260;   E260;   Essigsaeure;   Ethanoic acid;   Ethylic acid;   Formula=C2H4O2;   HOAc;   INS No. 260;   InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4);   InChIKey=QTBSBXVTEAMEQO-UHFFFAOYSA-N;   MeCO2H;   MeCOOH;   Methanecarboxylic acid;   SMILES=CC(O)=O;   acide acetique;   ethoic acid
 alt_id: CHEBI:22169;   CHEBI:2387;   CHEBI:40486
 xref: Beilstein:506007 "Beilstein";   CAS:64-19-7 "ChemIDplus";   CAS:64-19-7 "KEGG COMPOUND";   CAS:64-19-7 "NIST Chemistry WebBook";   Drug_Central:4211 "DrugCentral";   Gmelin:1380 "Gmelin";   HMDB:HMDB0000042;   KEGG:C00033;   KEGG:D00010;   KNApSAcK:C00001176;   LIPID_MAPS_instance:LMFA01010002 "LIPID MAPS"
 xref_mesh: MESH:D019342
 xref: MetaCyc:ACET;   PDBeChem:ACT;   PDBeChem:ACY;   PMID:12005138 "Europe PMC";   PMID:15107950 "Europe PMC";   PMID:16630552 "Europe PMC";   PMID:16774200 "Europe PMC";   PMID:17190852 "Europe PMC";   PMID:19416101 "Europe PMC";   PMID:19469536 "Europe PMC";   PMID:22153255 "Europe PMC";   PMID:22173419 "Europe PMC";   PPDB:1333;   Reaxys:506007 "Reaxys";   Wikipedia:Acetic_acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:30089


GViewer not supported for chinchilla.
show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    role 0
      application 0
        food additive 0
          food acidity regulator 0
            acetic acid 0
              (1-hydroxycyclohexyl)acetic acid + 0
              (2,2,2-trifluoroethoxy)acetic acid + 0
              (2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl)acetic acid + 0
              (2,6-dihydroxyphenyl)acetic acid 0
              (2-hydroxyphenyl)acetic acid 0
              (2S)-(\{(5Z)-5-[(5-ethylfuran-2-yl)methylidene]-4-oxo-4,5-dihydro-1,3-thiazol-2-yl\}amino)(4-fluorophenyl)acetic acid 0
              (2S)-[(2S,3S,4S,5S)-1,3,4,5-tetrahydroxy-4-(hydroxymethyl)piperidin-2-yl](L-tyrosylamino)acetic acid + 0
              (3-\{(1R)-3-(3,4-dimethoxyphenyl)-1-[(\{(2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)butanoyl]piperidin-2-yl\}carbonyl)oxy]propyl\}phenoxy)acetic acid 0
              (3-amino-2,5-dioxopyrrolidin-1-yl)acetic acid 0
              (3-chloro-4-hydroxyphenyl)acetic acid 0
              (3Z)-hex-3-en-1-yl acetate 0
              (4-oxo-3-\{[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl\}-3,4-dihydrophthalazin-1-yl)acetic acid 0
              (5-fluoro-2-\{[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]carbamoyl\}phenoxy)acetic acid 0
              1-O-palmityl-2-acetyl-sn-glycerol + 0
              1-alkyl-2-acetylglycerol + 0
              1-hexadecyl-2-acetyl-sn-glycero-3-phosphoethanolamine 0
              1-methyl-4-imidazoleacetic acid 0
              1-palmitoyl-2-acetyl-sn-glycero-3-phosphocholine 0
              1-palmityl-2-acetyl-sn-glycero-3-phosphate 0
              1-stearoyl-2-acetyl-sn-glycero-3-phosphocholine 0
              2-acetyl-sn-glycero-3-phosphocholine 0
              2-thienylacetic acid + 0
              2H-imidazol-4-ylacetic acid 0
              3-hydroxyphenylacetic acid 0
              3-methylphenylacetic acid 0
              4-chlorophenylacetic acid 0
              4-hydroxyphenylacetic acid + 0
              6-\{[1-(benzylsulfonyl)piperidin-4-yl]amino\}-3-(carboxymethoxy)thieno[3,2-b][1]benzothiophene-2-carboxylic acid 0
              N-acetyl-amino acid + 0
              N-phenylacetamide + 0
              O-acetylcarnitine + 0
              [(1S)-4-hydroxy-2,2,3-trimethylcyclopent-3-enyl]acetic acid 0
              [(2S,4S)-2-[(1R)-1-amino-2-hydroxyethyl]-4-(1H-imidazol-4-ylmethyl)-5-oxoimidazolidin-1-yl]acetic acid 0
              [(2S,4S)-2-[(1R)-1-amino-2-hydroxyethyl]-4-(4-hydroxybenzyl)-5-oxoimidazolidin-1-yl]acetic acid 0
              [(2S,4S)-2-[(1R)-1-amino-2-sulfanylethyl]-4-(4-hydroxybenzyl)-5-oxoimidazolidin-1-yl]acetic acid 0
              [5-fluoro-1-(4-isopropylbenzylidene)-2-methylinden-3-yl]acetic acid 0
              \{(2R)-2-[(1S)-1-aminoethyl]-2-hydroxy-4-methylidene-5-oxoimidazolidin-1-yl\}acetic acid 0
              \{(2R)-2-[(1S,2R)-1-amino-2-hydroxypropyl]-2-hydroxy-4,5-dioxoimidazolidin-1-yl\}acetic acid 0
              \{4-[(carboxymethoxy)carbonyl]-3,3-dioxido-1-oxonaphtho[1,2-d]-1,2-thiazol-2(1H)-yl\}acetic acid 0
              \{[5-(3-\{[1-(benzylsulfonyl)piperidin-4-yl]amino\}phenyl)-4-bromo-2-(2H-tetrazol-5-yl)thiophen-3-yl]oxy\}acetic acid 0
              \{[5-(5-nitro-2-furyl)-1,3,4-oxadiazol-2-yl]thio\}acetic acid 0
              acetamidine + 0
              acetate ester + 0
              acetimidic acid + 0
              acetyl chloride 0
              acetyl group + 0
              acetyl-CoA + 0
              acetyloxy group 0
              arsenoacetic acid 0
              biphenyl-4-ylacetic acid + 0
              bis(4-chlorophenyl)acetic acid 0
              carboxymethyl group + 0
              chloroacetic acid + 0
              cyanoacetic acid + 0
              cyclohexylacetic acid 0
              dibromoacetic acid 0
              dichloroacetic acid + 0
              diflorasone diacetate 0
              difluoroacetic acid 0
              diphenylacetic acid 0
              etacrynic acid 0
              glycolic acid + 0
              haloacetic acid + 0
              hydroxy(phenyl)2-thienylacetic acid 0
              ibufenac 0
              imidazol-1-ylacetic acid 0
              imidazol-2-ylacetic acid 0
              imidazol-4-ylacetic acid 0
              imidazol-5-ylacetic acid 0
              indole-1-acetic acid 0
              indole-3-acetic acids + 0
              lonazolac 0
              magnesium acetate 0
              mandelic acid + 0
              methoxyacetic acid 0
              methylenecarbonyl group 0
              naphthylacetic acid + 0
              phenylacetic acid + 0
              phosphonoacetic acid + 0
              phosphonoacetohydroxamic acid 0
              pirinixic acid 0
              sulfoacetic acid + 0
              sulindac + 0
              triacetin 0
              trichloroacetic acid + 0
              trifluoroacetic acid + 0
              uracil-6-ylacetic acid 0
              zomepirac 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        monocarboxylic acid 0
                                          acetic acid 0
                                            (1-hydroxycyclohexyl)acetic acid + 0
                                            (2,2,2-trifluoroethoxy)acetic acid + 0
                                            (2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl)acetic acid + 0
                                            (2,6-dihydroxyphenyl)acetic acid 0
                                            (2-hydroxyphenyl)acetic acid 0
                                            (2S)-(\{(5Z)-5-[(5-ethylfuran-2-yl)methylidene]-4-oxo-4,5-dihydro-1,3-thiazol-2-yl\}amino)(4-fluorophenyl)acetic acid 0
                                            (2S)-[(2S,3S,4S,5S)-1,3,4,5-tetrahydroxy-4-(hydroxymethyl)piperidin-2-yl](L-tyrosylamino)acetic acid + 0
                                            (3-\{(1R)-3-(3,4-dimethoxyphenyl)-1-[(\{(2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)butanoyl]piperidin-2-yl\}carbonyl)oxy]propyl\}phenoxy)acetic acid 0
                                            (3-amino-2,5-dioxopyrrolidin-1-yl)acetic acid 0
                                            (3-chloro-4-hydroxyphenyl)acetic acid 0
                                            (3Z)-hex-3-en-1-yl acetate 0
                                            (4-oxo-3-\{[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl\}-3,4-dihydrophthalazin-1-yl)acetic acid 0
                                            (5-fluoro-2-\{[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]carbamoyl\}phenoxy)acetic acid 0
                                            1-O-palmityl-2-acetyl-sn-glycerol + 0
                                            1-alkyl-2-acetylglycerol + 0
                                            1-hexadecyl-2-acetyl-sn-glycero-3-phosphoethanolamine 0
                                            1-methyl-4-imidazoleacetic acid 0
                                            1-palmitoyl-2-acetyl-sn-glycero-3-phosphocholine 0
                                            1-palmityl-2-acetyl-sn-glycero-3-phosphate 0
                                            1-stearoyl-2-acetyl-sn-glycero-3-phosphocholine 0
                                            2-acetyl-sn-glycero-3-phosphocholine 0
                                            2-thienylacetic acid + 0
                                            2H-imidazol-4-ylacetic acid 0
                                            3-hydroxyphenylacetic acid 0
                                            3-methylphenylacetic acid 0
                                            4-chlorophenylacetic acid 0
                                            4-hydroxyphenylacetic acid + 0
                                            6-\{[1-(benzylsulfonyl)piperidin-4-yl]amino\}-3-(carboxymethoxy)thieno[3,2-b][1]benzothiophene-2-carboxylic acid 0
                                            N-acetyl-amino acid + 0
                                            N-phenylacetamide + 0
                                            O-acetylcarnitine + 0
                                            [(1S)-4-hydroxy-2,2,3-trimethylcyclopent-3-enyl]acetic acid 0
                                            [(2S,4S)-2-[(1R)-1-amino-2-hydroxyethyl]-4-(1H-imidazol-4-ylmethyl)-5-oxoimidazolidin-1-yl]acetic acid 0
                                            [(2S,4S)-2-[(1R)-1-amino-2-hydroxyethyl]-4-(4-hydroxybenzyl)-5-oxoimidazolidin-1-yl]acetic acid 0
                                            [(2S,4S)-2-[(1R)-1-amino-2-sulfanylethyl]-4-(4-hydroxybenzyl)-5-oxoimidazolidin-1-yl]acetic acid 0
                                            [5-fluoro-1-(4-isopropylbenzylidene)-2-methylinden-3-yl]acetic acid 0
                                            \{(2R)-2-[(1S)-1-aminoethyl]-2-hydroxy-4-methylidene-5-oxoimidazolidin-1-yl\}acetic acid 0
                                            \{(2R)-2-[(1S,2R)-1-amino-2-hydroxypropyl]-2-hydroxy-4,5-dioxoimidazolidin-1-yl\}acetic acid 0
                                            \{4-[(carboxymethoxy)carbonyl]-3,3-dioxido-1-oxonaphtho[1,2-d]-1,2-thiazol-2(1H)-yl\}acetic acid 0
                                            \{[5-(3-\{[1-(benzylsulfonyl)piperidin-4-yl]amino\}phenyl)-4-bromo-2-(2H-tetrazol-5-yl)thiophen-3-yl]oxy\}acetic acid 0
                                            \{[5-(5-nitro-2-furyl)-1,3,4-oxadiazol-2-yl]thio\}acetic acid 0
                                            acetamidine + 0
                                            acetate ester + 0
                                            acetimidic acid + 0
                                            acetyl chloride 0
                                            acetyl group + 0
                                            acetyl-CoA + 0
                                            acetyloxy group 0
                                            arsenoacetic acid 0
                                            biphenyl-4-ylacetic acid + 0
                                            bis(4-chlorophenyl)acetic acid 0
                                            carboxymethyl group + 0
                                            chloroacetic acid + 0
                                            cyanoacetic acid + 0
                                            cyclohexylacetic acid 0
                                            dibromoacetic acid 0
                                            dichloroacetic acid + 0
                                            diflorasone diacetate 0
                                            difluoroacetic acid 0
                                            diphenylacetic acid 0
                                            etacrynic acid 0
                                            glycolic acid + 0
                                            haloacetic acid + 0
                                            hydroxy(phenyl)2-thienylacetic acid 0
                                            ibufenac 0
                                            imidazol-1-ylacetic acid 0
                                            imidazol-2-ylacetic acid 0
                                            imidazol-4-ylacetic acid 0
                                            imidazol-5-ylacetic acid 0
                                            indole-1-acetic acid 0
                                            indole-3-acetic acids + 0
                                            lonazolac 0
                                            magnesium acetate 0
                                            mandelic acid + 0
                                            methoxyacetic acid 0
                                            methylenecarbonyl group 0
                                            naphthylacetic acid + 0
                                            phenylacetic acid + 0
                                            phosphonoacetic acid + 0
                                            phosphonoacetohydroxamic acid 0
                                            pirinixic acid 0
                                            sulfoacetic acid + 0
                                            sulindac + 0
                                            triacetin 0
                                            trichloroacetic acid + 0
                                            trifluoroacetic acid + 0
                                            uracil-6-ylacetic acid 0
                                            zomepirac 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.