ONTOLOGY REPORT - ANNOTATIONS |
|
Term: | prostaglandin E1 |
|
Accession: | CHEBI:15544
|
browse the term
|
Definition: | A prostaglandins E that has formula C20H34O5. |
Synonyms: | exact_synonym: | (13E,15S)-11alpha,15-dihydroxy-9-oxoprost-13-en-1-oic acid |
| related_synonym: | (11alpha,13E,15S)-11,15-dihydroxy-9-oxoprost-13-en-1-oic acid; (13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprost-13-enoate; 11alpha,15alpha-dihydroxy-9-oxo-13-trans-prostenoic acid; Alprostadil; Befar; Caverject; Edex; Formula=C20H34O5; InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,19+/m0/s1; InChIKey=GMVPRGQOIOIIMI-DWKJAMRDSA-N; Muse; PGE-1; PGE1; Prostin VR; SMILES=CCCCC[C@H](O)\\C=C\\[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(O)=O; alprostadilum |
| alt_id: | CHEBI:10820; CHEBI:142; CHEBI:26322 |
| xref: | Beilstein:2061617 "Beilstein"; CAS:745-65-3 "ChemIDplus"; CAS:745-65-3 "KEGG COMPOUND"; DrugBank:DB00770; Drug_Central:138 "DrugCentral"; HMDB:HMDB0001442; KEGG:C04741; KEGG:D00180; LIPID_MAPS_instance:LMFA03010134 "LIPID MAPS" |
| xref_mesh: | MESH:D000527 |
| xref: | PMID:15295081 "Europe PMC"; PMID:18176061 "Europe PMC"; PMID:7732902 "Europe PMC"; Reaxys:2061617 "Reaxys"; Wikipedia:Prostaglandin_E1 |
| cyclic_relationship: | is_conjugate_acid_of CHEBI:57397 |
|
|
|
G |
Abcc4 |
ATP binding cassette subfamily C member 4 |
|
15 |
103,695,415 |
103,927,980 |
RGD:6480464 |
G |
Adrb2 |
adrenoceptor beta 2 |
|
18 |
57,513,792 |
57,515,834 |
RGD:6480464 |
G |
Agt |
angiotensinogen |
|
19 |
57,321,594 |
57,333,460 |
RGD:6480464 |
G |
Casp3 |
caspase 3 |
|
16 |
48,845,011 |
48,863,249 |
RGD:6480464 |
G |
Cxcl2 |
C-X-C motif chemokine ligand 2 |
|
14 |
18,731,346 |
18,733,391 |
RGD:6480464 |
G |
Il23a |
interleukin 23 subunit alpha |
|
7 |
2,710,609 |
2,712,723 |
RGD:6480464 |
G |
Il6 |
interleukin 6 |
|
4 |
3,043,231 |
3,047,807 |
RGD:6480464 |
G |
Nfkbia |
NFKB inhibitor alpha |
|
6 |
76,267,227 |
76,270,457 |
RGD:6480464 |
G |
Nos2 |
nitric oxide synthase 2 |
|
10 |
66,188,290 |
66,221,621 |
RGD:6480464 |
G |
Nppa |
natriuretic peptide A |
|
5 |
164,808,407 |
164,809,716 |
RGD:6480464 |
G |
Nppb |
natriuretic peptide B |
|
5 |
164,796,176 |
164,797,538 |
RGD:6480464 |
G |
Ptgdr |
prostaglandin D2 receptor |
|
15 |
19,195,606 |
19,196,508 |
RGD:6480464 |
G |
Rela |
RELA proto-oncogene, NF-kB subunit |
|
1 |
220,992,770 |
221,003,249 |
RGD:6480464 |
G |
Ren |
renin |
|
13 |
50,502,724 |
50,513,953 |
RGD:6480464 |
G |
Timp1 |
TIMP metallopeptidase inhibitor 1 |
|
X |
1,364,771 |
1,369,451 |
RGD:6480464 |
G |
Tnf |
tumor necrosis factor |
|
20 |
5,189,382 |
5,192,000 |
RGD:6480464 |
G |
Tnfrsf11b |
TNF receptor superfamily member 11B |
|
7 |
93,798,580 |
93,826,586 |
RGD:6480464 |
G |
Vasp |
vasodilator-stimulated phosphoprotein |
|
1 |
80,170,608 |
80,185,882 |
RGD:6480464 |
|
G |
Ptgr1 |
prostaglandin reductase 1 |
|
5 |
76,110,746 |
76,129,361 |
RGD:6480464 |
Term paths to the root
|