Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:2-dehydro-3-deoxy-D-fuconic acid
go back to main search page
Accession:CHEBI:18104 term browser browse the term
Definition:A ketoaldonic acid comprising D-fuconic acid lacking the 3-hydroxy substituent and having a keto group at the 2-position.
Synonyms:exact_synonym: 3,6-dideoxy-D-threo-hex-2-ulosonic acid
 related_synonym: 2-Dehydro-3-deoxy-D-fuconate;   Formula=C6H10O5;   InChI=1S/C6H10O5/c1-3(7)4(8)2-5(9)6(10)11/h3-4,7-8H,2H2,1H3,(H,10,11)/t3-,4-/m1/s1;   InChIKey=FRIWJYNKZPJVRL-QWWZWVQMSA-N;   SMILES=C[C@@H](O)[C@H](O)CC(=O)C(O)=O
 alt_id: CHEBI:1055;   CHEBI:11546;   CHEBI:19526
 xref: KEGG:C06159
 cyclic_relationship: is_conjugate_acid_of CHEBI:58378


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    role 0
      chemical role 0
        donor 0
          Bronsted acid 0
            oxoacid 0
              carbon oxoacid 0
                carboxylic acid 0
                  carbohydrate acid 0
                    ketoaldonic acid 0
                      2-dehydro-3-deoxy-D-fuconic acid 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        monocarboxylic acid 0
                                          aldonic acid 0
                                            hexonic acid 0
                                              fuconic acid 0
                                                D-fuconic acid 0
                                                  2-dehydro-3-deoxy-D-fuconic acid 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.