Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:folic acid
go back to main search page
Accession:CHEBI:27470 term browser browse the term
Definition:An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation.
Synonyms:related_synonym: Folate;   Folsaeure;   Formula=C19H19N7O6;   InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1;   InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-N;   N-(4-{[(2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid;   N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid;   N-pteroyl-L-glutamic acid;   PGA;   PteGlu;   Pteroylglutamic acid;   SMILES=Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1;   pteroyl-L-glutamic acid;   pteroyl-L-monoglutamic acid;   vitamin Bc;   vitamin M
 alt_id: CHEBI:24075;   CHEBI:42610;   CHEBI:5140;   CHEBI:569217
 xref: Beilstein:100781 "Beilstein";   CAS:59-30-3 "ChemIDplus";   CAS:59-30-3 "KEGG COMPOUND";   CAS:59-30-3 "NIST Chemistry WebBook";   DrugBank:DB00158;   Drug_Central:1231 "DrugCentral";   KEGG:C00504;   KEGG:D00070;   KNApSAcK:C00001539;   LINCS:LSM-5355
 xref_mesh: MESH:D005492
 xref: MetaCyc:CPD-12826;   PDBeChem:FOL;   PMID:11261364 "Europe PMC";   PMID:11451208 "Europe PMC";   PMID:14387833 "Europe PMC";   PMID:15754725 "Europe PMC";   PMID:17784727 "Europe PMC";   PMID:18788725 "ChEMBL";   PMID:19355913 "Europe PMC";   PMID:24650098 "Europe PMC";   PMID:9040515 "Europe PMC";   Reaxys:100781 "Reaxys";   Wikipedia:Folic_Acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:62501


show annotations for term's descendants       view all columns           Sort by:
 





Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19669
    role 19613
      biological role 19611
        physiological role 19603
          food component 19603
            nutrient 19599
              folic acid 3659
                4-aminofolic acid 0
                vitamin B complex 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19669
    subatomic particle 19665
      composite particle 19665
        hadron 19665
          baryon 19665
            nucleon 19665
              atomic nucleus 19665
                atom 19665
                  main group element atom 19545
                    p-block element atom 19545
                      carbon group element atom 19428
                        carbon atom 19420
                          organic molecular entity 19420
                            organic group 18343
                              organic divalent group 18334
                                organodiyl group 18334
                                  carbonyl group 18222
                                    carbonyl compound 18222
                                      carboxylic acid 17923
                                        amino acid 12315
                                          alpha-amino acid 7422
                                            L-alpha-amino acid 7079
                                              glutamine family amino acid 5338
                                                L-glutamic acid 5240
                                                  L-glutamic acid derivative 3694
                                                    folic acids 3690
                                                      folic acid 3659
                                                        4-aminofolic acid 0
                                                        vitamin B complex 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.