Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:folic acid
go back to main search page
Accession:CHEBI:27470 term browser browse the term
Definition:An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation.
Synonyms:related_synonym: Folate;   Folsaeure;   Formula=C19H19N7O6;   InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1;   InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-N;   N-(4-{[(2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid;   N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid;   N-pteroyl-L-glutamic acid;   PGA;   PteGlu;   Pteroylglutamic acid;   SMILES=Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1;   pteroyl-L-glutamic acid;   pteroyl-L-monoglutamic acid;   vitamin Bc;   vitamin M
 alt_id: CHEBI:24075;   CHEBI:42610;   CHEBI:5140;   CHEBI:569217
 xref: Beilstein:100781 "Beilstein";   CAS:59-30-3 "ChemIDplus";   CAS:59-30-3 "KEGG COMPOUND";   CAS:59-30-3 "NIST Chemistry WebBook";   DrugBank:DB00158;   Drug_Central:1231 "DrugCentral";   KEGG:C00504;   KEGG:D00070;   KNApSAcK:C00001539;   LINCS:LSM-5355
 xref_mesh: MESH:D005492
 xref: MetaCyc:CPD-12826;   PDBeChem:FOL;   PMID:11261364 "Europe PMC";   PMID:11451208 "Europe PMC";   PMID:14387833 "Europe PMC";   PMID:15754725 "Europe PMC";   PMID:17784727 "Europe PMC";   PMID:18788725 "ChEMBL";   PMID:19355913 "Europe PMC";   PMID:24650098 "Europe PMC";   PMID:9040515 "Europe PMC";   Reaxys:100781 "Reaxys";   Wikipedia:Folic_Acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:62501


show annotations for term's descendants       view all columns           Sort by:
 





Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 23758
    role 23647
      biological role 23610
        physiological role 23545
          food component 23545
            nutrient 23537
              folic acid 3725
                4-aminofolic acid 0
                vitamin B complex 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 23758
    subatomic particle 23707
      composite particle 23707
        hadron 23707
          baryon 23707
            nucleon 23707
              atomic nucleus 23707
                atom 23707
                  main group element atom 23527
                    p-block element atom 23527
                      carbon group element atom 23238
                        carbon atom 23215
                          organic molecular entity 23215
                            organic group 21900
                              organic divalent group 21872
                                organodiyl group 21872
                                  carbonyl group 21843
                                    carbonyl compound 21843
                                      carboxylic acid 20891
                                        amino acid 13055
                                          alpha-amino acid 7883
                                            L-alpha-amino acid 7534
                                              glutamine family amino acid 5522
                                                L-glutamic acid 5423
                                                  L-glutamic acid derivative 3766
                                                    folic acids 3758
                                                      folic acid 3725
                                                        4-aminofolic acid 0
                                                        vitamin B complex 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.