Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:folic acid
go back to main search page
Accession:CHEBI:27470 term browser browse the term
Definition:An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation.
Synonyms:related_synonym: Folate;   Folsaeure;   Formula=C19H19N7O6;   InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1;   InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-N;   N-(4-{[(2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid;   N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid;   N-pteroyl-L-glutamic acid;   PGA;   PteGlu;   Pteroylglutamic acid;   SMILES=Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1;   pteroyl-L-glutamic acid;   pteroyl-L-monoglutamic acid;   vitamin Bc;   vitamin M
 alt_id: CHEBI:24075;   CHEBI:42610;   CHEBI:5140;   CHEBI:569217
 xref: Beilstein:100781 "Beilstein";   CAS:59-30-3 "ChemIDplus";   CAS:59-30-3 "KEGG COMPOUND";   CAS:59-30-3 "NIST Chemistry WebBook";   DrugBank:DB00158;   Drug_Central:1231 "DrugCentral";   KEGG:C00504;   KEGG:D00070;   KNApSAcK:C00001539;   LINCS:LSM-5355
 xref_mesh: MESH:D005492
 xref: MetaCyc:CPD-12826;   PDBeChem:FOL;   PMID:11261364 "Europe PMC";   PMID:11451208 "Europe PMC";   PMID:14387833 "Europe PMC";   PMID:15754725 "Europe PMC";   PMID:17784727 "Europe PMC";   PMID:18788725 "ChEMBL";   PMID:19355913 "Europe PMC";   PMID:24650098 "Europe PMC";   PMID:9040515 "Europe PMC";   Reaxys:100781 "Reaxys";   Wikipedia:Folic_Acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:62501


show annotations for term's descendants       view all columns           Sort by:
 





Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 20965
    role 20946
      biological role 20944
        physiological role 20905
          food component 20905
            nutrient 20792
              folic acid 3785
                4-aminofolic acid 0
                vitamin B complex 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 20965
    subatomic particle 20959
      composite particle 20959
        hadron 20959
          baryon 20959
            nucleon 20959
              atomic nucleus 20959
                atom 20959
                  main group element atom 20796
                    p-block element atom 20796
                      carbon group element atom 20536
                        carbon atom 20512
                          organic molecular entity 20512
                            organic group 19164
                              organic divalent group 19154
                                organodiyl group 19154
                                  carbonyl group 19124
                                    carbonyl compound 19124
                                      carboxylic acid 18804
                                        amino acid 12658
                                          alpha-amino acid 7783
                                            L-alpha-amino acid 7434
                                              glutamine family amino acid 5506
                                                L-glutamic acid 5404
                                                  L-glutamic acid derivative 3823
                                                    folic acids 3816
                                                      folic acid 3785
                                                        4-aminofolic acid 0
                                                        vitamin B complex 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.