Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:folic acid
go back to main search page
Accession:CHEBI:27470 term browser browse the term
Definition:An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation.
Synonyms:related_synonym: Folate;   Folsaeure;   Formula=C19H19N7O6;   InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1;   InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-N;   N-(4-{[(2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid;   N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid;   N-pteroyl-L-glutamic acid;   PGA;   PteGlu;   Pteroylglutamic acid;   SMILES=Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1;   pteroyl-L-glutamic acid;   pteroyl-L-monoglutamic acid;   vitamin Bc;   vitamin M
 alt_id: CHEBI:24075;   CHEBI:42610;   CHEBI:5140;   CHEBI:569217
 xref: Beilstein:100781;   CAS:59-30-3;   DrugBank:DB00158;   Drug_Central:1231;   KEGG:C00504;   KEGG:D00070;   KNApSAcK:C00001539;   LINCS:LSM-5355
 xref_mesh: MESH:D005492
 xref: MetaCyc:CPD-12826;   PDBeChem:FOL;   PMID:11261364;   PMID:11451208;   PMID:14387833;   PMID:15754725;   PMID:17784727;   PMID:18788725;   PMID:19355913;   PMID:24650098;   PMID:9040515;   Reaxys:100781;   Wikipedia:Folic_Acid
 cyclic_relationship: is_conjugate_acid_of CHEBI:62501


show annotations for term's descendants       view all columns           Sort by:
 





Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19770
    role 19717
      biological role 19716
        physiological role 19708
          food component 19708
            nutrient 19704
              folic acid 3670
                4-aminofolic acid 0
                vitamin B complex 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19770
    subatomic particle 19768
      composite particle 19768
        hadron 19768
          baryon 19768
            nucleon 19768
              atomic nucleus 19768
                atom 19768
                  main group element atom 19653
                    p-block element atom 19653
                      carbon group element atom 19548
                        carbon atom 19537
                          organic molecular entity 19537
                            organic group 18465
                              organic divalent group 18458
                                organodiyl group 18458
                                  carbonyl group 18354
                                    carbonyl compound 18354
                                      carboxylic acid 18033
                                        amino acid 12477
                                          alpha-amino acid 7698
                                            L-alpha-amino acid 7368
                                              glutamine family amino acid 5359
                                                L-glutamic acid 5257
                                                  L-glutamic acid derivative 3709
                                                    folic acids 3702
                                                      folic acid 3670
                                                        4-aminofolic acid 0
                                                        vitamin B complex 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.