Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:selenocystine
go back to main search page
Accession:CHEBI:28553 term browser browse the term
Definition:A diselenide that has formula C6H12N2O4Se2.
Synonyms:exact_synonym: 3,3'-diselane-1,2-diylbis(2-aminopropanoic acid)
 related_synonym: 3,3'-Diselenobisalanine;   3,3'-Diselenodialanine;   Formula=C6H12N2O4Se2;   InChI=1S/C6H12N2O4Se2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);   InChIKey=JULROCUWKLNBSN-UHFFFAOYSA-N;   SMILES=NC(C[Se][Se]CC(N)C(O)=O)C(O)=O
 alt_id: CHEBI:26633;   CHEBI:9095
 xref: Beilstein:1969559 "Beilstein";   CAS:1464-43-3 "ChemIDplus";   KEGG:C05704
 xref_mesh: MESH:C009226


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          selenium atom 0
            selenium molecular entity 0
              diselenide 0
                selenocystine 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        amino acid 0
                                          alpha-amino acid 0
                                            selenocysteine 0
                                              selenocystine 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.