Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:nojirimycin
go back to main search page
Accession:CHEBI:28945 term browser browse the term
Definition:An amino monosaccharide that has formula C6H13NO5.
Synonyms:related_synonym: (3R,4S,5R,6R)-6-(hydroxymethyl)piperidine-2,3,4,5-tetrol;   5-Amino-5-deoxy-D-glucopyranose;   Formula=C6H13NO5;   InChI=1S/C6H13NO5/c8-1-2-3(9)4(10)5(11)6(12)7-2/h2-12H,1H2/t2-,3-,4+,5-,6?/m1/s1;   InChIKey=BGMYHTUCJVZIRP-GASJEMHNSA-N;   SMILES=OC[C@H]1NC(O)[C@H](O)[C@@H](O)[C@@H]1O
 alt_id: CHEBI:25574;   CHEBI:7608
 xref: CAS:15218-38-9 "KEGG COMPOUND";   KEGG:C06763;   KNApSAcK:C00018724


GViewer not supported for chinchilla.
show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          nitrogen atom 0
            nitrogen molecular entity 0
              organonitrogen compound 0
                organonitrogen heterocyclic compound 0
                  piperidines 0
                    hydroxypiperidine 0
                      nojirimycin 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            heteroorganic entity 0
                              organochalcogen compound 0
                                organooxygen compound 0
                                  carbohydrates and carbohydrate derivatives 0
                                    carbohydrate 0
                                      carbohydrate derivative 0
                                        amino sugar 0
                                          amino monosaccharide 0
                                            nojirimycin 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.