Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:2,5-dichloro-4-oxohex-2-enedioic acid
go back to main search page
Accession:CHEBI:31074 term browser browse the term
Definition:An alpha,omega-dicarboxylic acid that is hexanedioic acid containing a double bond between positions 2 and 3, an oxo group at position 4, and two chlorine atoms (at positions 2 and 5).
Synonyms:related_synonym: 2,5-Dichloro-4-oxohex-2-enedioate;   Formula=C6H4Cl2O5;   InChI=1S/C6H4Cl2O5/c7-2(5(10)11)1-3(9)4(8)6(12)13/h1,4H,(H,10,11)(H,12,13);   InChIKey=PLPVRWUZGSFJJB-UHFFFAOYSA-N;   SMILES=[H]C(C(=O)C(Cl)C(O)=O)=C(Cl)C(O)=O
 xref: KEGG:C12835
 cyclic_relationship: is_conjugate_acid_of CHEBI:19373


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19745
    chemical entity 19743
      atom 19741
        nonmetal atom 19613
          halogen 17780
            chlorine atom 17522
              chlorine molecular entity 17522
                organochlorine compound 17119
                  2,5-dichloro-4-oxohex-2-enedioic acid 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19745
    subatomic particle 19741
      composite particle 19741
        hadron 19741
          baryon 19741
            nucleon 19741
              atomic nucleus 19741
                atom 19741
                  main group element atom 19625
                    p-block element atom 19625
                      carbon group element atom 19519
                        carbon atom 19513
                          organic molecular entity 19513
                            organic group 18424
                              organic divalent group 18416
                                organodiyl group 18416
                                  carbonyl group 18304
                                    carbonyl compound 18304
                                      dicarboxylic acids and O-substituted derivatives 10207
                                        dicarboxylic acid 10201
                                          hexenedioic acid 0
                                            2-hexenedioic acid 0
                                              4-oxohex-2-enedioic acid 0
                                                2,5-dichloro-4-oxohex-2-enedioic acid 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.