Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


Term:icosa-5,8,12,14-tetraenoic acid
go back to main search page
Accession:CHEBI:36302 term browser browse the term
Definition:Any icosatetraenoic acid with the double bonds at positions 5, 8, 12 and 14.
Synonyms:related_synonym: 5,8,12,14-18:4;   5,8,12,14-eicosatetraenoic acid;   5,8,12,14-eicosatetraenoic acids;   5,8,12,14-icosatetraenoic acid;   5,8,12,14-icosatetraenoic acids;   C18:4, n-6,8,12,15;   Formula=C20H32O2;   InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-9,12-13,15-16H,2-5,10-11,14,17-19H2,1H3,(H,21,22);   InChIKey=MTNWQVQXYXBHKL-UHFFFAOYSA-N;   SMILES=[H]C(CCCC(O)=O)=CCC([H])=CCCC([H])=CC([H])=CCCCCC;   eicosa-5,8,12,14-tetraenoic acid;   eicosa-5,8,12,14-tetraenoic acids;   icosa-5,8,12,14-tetraenoic acids

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          carbon atom 0
            organic molecular entity 0
              olefinic compound 0
                olefinic fatty acid 0
                  icosatetraenoic acid 0
                    icosa-5,8,12,14-tetraenoic acid 0
                      11(R)-HPETE 0
                      11-HETE + 0
                      11-oxo-ETE + 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        monocarboxylic acid 0
                                          fatty acid 0
                                            unsaturated fatty acid 0
                                              polyunsaturated fatty acid 0
                                                fatty acid 20:4 0
                                                  icosatetraenoic acid 0
                                                    icosa-5,8,12,14-tetraenoic acid 0
                                                      11(R)-HPETE 0
                                                      11-HETE + 0
                                                      11-oxo-ETE + 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.