Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:phthalimide
go back to main search page
Accession:CHEBI:38817 term browser browse the term
Definition:A dicarboximide that is 2,3-dihydro-1H-isoindole substituted by oxo groups at positions 1 and 3.
Synonyms:related_synonym: 1,3-Isoindolinedione;   1H-Isoindole-1,3(2H)-dione;   2-Diazoindan-1,3-dione;   Formula=C8H5NO2;   InChI=1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-4H,(H,9,10,11);   InChIKey=XKJCHHZQLQNZHY-UHFFFAOYSA-N;   SMILES=O=C1NC(=O)c2ccccc12;   o-Phthalic imide
 xref: Beilstein:118522;   CAS:85-41-6
 xref_mesh: MESH:C037431
 xref: PMID:16610900;   PMID:24171082;   Reaxys:118522;   Wikipedia:Phthalimide


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          nitrogen atom 0
            nitrogen molecular entity 0
              organonitrogen compound 0
                organonitrogen heterocyclic compound 0
                  benzopyrrole 0
                    isoindoles 0
                      phthalimides 0
                        phthalimide 0
                          4-nitrophenyl phthalimidoacetate 0
                          N-(hydroxymethyl)phthalimide + 0
                          N-phthaloyl-L-glutamic acid 0
                          folpet 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic molecule 0
                              organic cyclic compound 0
                                organic heterocyclic compound 0
                                  organic heteropolycyclic compound 0
                                    organic heterobicyclic compound 0
                                      benzopyrrole 0
                                        isoindoles 0
                                          phthalimides 0
                                            phthalimide 0
                                              4-nitrophenyl phthalimidoacetate 0
                                              N-(hydroxymethyl)phthalimide + 0
                                              N-phthaloyl-L-glutamic acid 0
                                              folpet 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.