Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:40071 term browser browse the term
Definition:A benzoisoquinoline that has formula C12H8N2O2.
Synonyms:related_synonym: 4-aminonaphthalene-1,8-dicarboximide;   4-aminonaphthalimide;   6-AMINO-BENZO[DE]ISOQUINOLINE-1,3-DIONE;   6-amino-1H-benzo[de]isoquinoline-1,3(2H)-dione;   Formula=C12H8N2O2;   InChI=1S/C12H8N2O2/c13-9-5-4-8-10-6(9)2-1-3-7(10)11(15)14-12(8)16/h1-5H,13H2,(H,14,15,16);   InChIKey=SSMIFVHARFVINF-UHFFFAOYSA-N;   SMILES=Nc1ccc2C(=O)NC(=O)c3cccc1c23
 alt_id: CHEBI:36675;   CHEBI:40064
 xref: CAS:1742-95-6;   DrugBank:DB07096;   LINCS:LSM-3103
 xref_mesh: MESH:C086538
 xref: PDBeChem:4AN

GViewer not supported for chinchilla.
show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          nitrogen atom 0
            nitrogen molecular entity 0
              organonitrogen compound 0
                organonitrogen heterocyclic compound 0
                  benzoisoquinoline 0
                    4-amino-1,8-naphthalimide 0
                      lucifer yellow anion + 0
                      lucifer yellow dye 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic molecule 0
                              organic cyclic compound 0
                                organic heterocyclic compound 0
                                  organic heteropolycyclic compound 0
                                    organic heterotricyclic compound 0
                                      benzoisoquinoline 0
                                        4-amino-1,8-naphthalimide 0
                                          lucifer yellow anion + 0
                                          lucifer yellow dye 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.