Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


Term:salicylhydroxamic acid
go back to main search page
Accession:CHEBI:45615 term browser browse the term
Definition:A hydroxamic acid that is N-hydroxybenzamide carrying a phenolic hydroxy group at position 2.
Synonyms:related_synonym: 2-Hydroxybenzhydroxamic acid;   2-Hydroxybenzohydroxamic acid;   Formula=C7H7NO3;   InChI=1S/C7H7NO3/c9-6-4-2-1-3-5(6)7(10)8-11/h1-4,9,11H,(H,8,10);   InChIKey=HBROZNQEVUILML-UHFFFAOYSA-N;   N,2-dihydroxybenzamide;   SHAM;   SMILES=ONC(=O)c1ccccc1O;   Salicylohydroximic acid;   o-Hydroxybenzohydroxamic acid
 alt_id: CHEBI:9007
 xref: CAS:89-73-6;   DrugBank:DB03819;   KEGG:C11343
 xref_mesh: MESH:C005703
 xref: MetaCyc:CPD-6543;   PDBeChem:SHA;   PMID:16667326;   PMID:1847381;   PMID:22554042;   PMID:23416493;   PMID:24603484;   PMID:24888389;   PMID:2543361;   Patent:CN101519365;   Reaxys:1210520;   Wikipedia:Salicylhydroxamic_acid

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    role 0
      biological role 0
        antimicrobial agent 0
          antibacterial agent 0
            antibacterial drug 0
              salicylhydroxamic acid 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        carboacyl group 0
                                          univalent carboacyl group 0
                                            carbamoyl group 0
                                              carboxamide 0
                                                hydroxamic acid 0
                                                  salicylhydroxamic acid 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.