Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:thioglycine
go back to main search page
Accession:CHEBI:46799 term browser browse the term
Definition:A monothiocarboxylic acid that is the thiolacid analogue of glycine. The parent of the class of thioglycines.
Synonyms:exact_synonym: aminoethanethioic S-acid
 related_synonym: Amino-monothioessigsaeure;   Formula=C2H5NOS;   InChI=1S/C2H5NOS/c3-1-2(4)5/h1,3H2,(H,4,5);   InChIKey=CYFJIBWZIQDUSZ-UHFFFAOYSA-N;   SMILES=NCC(S)=O;   THIOGLYCIN;   alpha-Amino-thioessigsaeure;   aminothioacetic acid
 alt_id: CHEBI:19106;   CHEBI:42792
 xref: Beilstein:2070472 "Beilstein";   CAS:758-10-1 "NIST Chemistry WebBook";   Gmelin:396676 "Gmelin";   PDBeChem:GL3;   Reaxys:2070472 "Reaxys"


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          sulfur atom 0
            sulfur molecular entity 0
              organosulfur compound 0
                thioglycine 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        amino acid 0
                                          alpha-amino acid 0
                                            L-alpha-amino acid 0
                                              serine family amino acid 0
                                                glycine 0
                                                  glycine derivative 0
                                                    thioglycines 0
                                                      thioglycine 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.