Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:N-hydroxytrihomomethionine
go back to main search page
Accession:CHEBI:50761 term browser browse the term
Definition:An N-hydroxy-alpha-amino acid having a 6-thiaheptyl substituent at the 2-position.
Synonyms:exact_synonym: 2-(hydroxyamino)-7-(methylsulfanyl)heptanoic acid
 related_synonym: Formula=C8H17NO3S;   InChI=1S/C8H17NO3S/c1-13-6-4-2-3-5-7(9-12)8(10)11/h7,9,12H,2-6H2,1H3,(H,10,11);   InChIKey=JCEAPZJPOHTKKJ-UHFFFAOYSA-N;   SMILES=CSCCCCCC(NO)C(O)=O
 cyclic_relationship: is_conjugate_acid_of CHEBI:58841


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19779
    chemical entity 19778
      atom 19777
        nonmetal atom 19651
          nitrogen atom 18458
            nitrogen molecular entity 18458
              hydroxylamines 2582
                N-hydroxy-alpha-amino-acid 0
                  N-hydroxytrihomomethionine 0
                    N-hydroxy-L-trihomomethionine 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19779
    subatomic particle 19777
      composite particle 19777
        hadron 19777
          baryon 19777
            nucleon 19777
              atomic nucleus 19777
                atom 19777
                  main group element atom 19664
                    p-block element atom 19664
                      carbon group element atom 19559
                        carbon atom 19548
                          organic molecular entity 19548
                            organic group 18463
                              organic divalent group 18456
                                organodiyl group 18456
                                  carbonyl group 18356
                                    carbonyl compound 18356
                                      carboxylic acid 18027
                                        amino acid 12478
                                          alpha-amino acid 7713
                                            non-proteinogenic alpha-amino acid 1531
                                              hydroxy-amino acid 0
                                                N-hydroxy-alpha-amino-acid 0
                                                  N-hydroxytrihomomethionine 0
                                                    N-hydroxy-L-trihomomethionine 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.