Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:D-ascorbic acid
go back to main search page
Accession:CHEBI:51384 term browser browse the term
Definition:An ascorbic acid that has formula C6H8O6.
Synonyms:exact_synonym: (5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyfuran-2(5H)-one;   D-threo-hex-2-enono-1,4-lactone
 related_synonym: D-lyxoascorbic acid;   D-threo-hex-2-enoic acid gamma-lactone;   D-xyloascorbic acid;   Formula=C6H8O6;   InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m1/s1;   InChIKey=CIWBSHSKHKDKBQ-MVHIGOERSA-N;   SMILES=[H][C@]1(OC(=O)C(O)=C1O)[C@H](O)CO
 xref: Beilstein:84273;   CAS:10504-35-5
 cyclic_relationship: is_enantiomer_of CHEBI:29073


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    role 0
      chemical role 0
        donor 0
          Bronsted acid 0
            oxoacid 0
              carbon oxoacid 0
                carboxylic acid 0
                  carbohydrate acid 0
                    ketoaldonic acid 0
                      ascorbic acid 0
                        D-ascorbic acid 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        carbohydrate acid 0
                                          ketoaldonic acid 0
                                            ascorbic acid 0
                                              D-ascorbic acid 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.