Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:52402 term browser browse the term
Definition:A 1-deoxy-D-ribitol-5-phosphate having a (5,6-diamino-4-oxopyrimidin-2-yl)amino group at the 1-position.
Synonyms:exact_synonym: 1-[(5-amino-6-hydroxy-2-imino-2,3-dihydropyrimidin-4-yl)amino]-1-deoxy-5-O-phosphono-D-ribitol;   1-deoxy-1-[(2,5-diamino-6-oxo-1,6-dihydropyrimidin-4-yl)amino]-5-O-phosphono-D-ribitol
 related_synonym: 2,5-Diamino-6-(1-D-ribitylamino)pyrimidin-4(3H)-one 5'-phosphate;   2,5-diamino-6-(1-D-ribitylamino)-4(3H)-pyrimidinone 5'-phosphate;   2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one;   Formula=C9H18N5O8P;   InChI=1S/C9H18N5O8P/c10-5-7(13-9(11)14-8(5)18)12-1-3(15)6(17)4(16)2-22-23(19,20)21/h3-4,6,15-17H,1-2,10H2,(H2,19,20,21)(H4,11,12,13,14,18)/t3-,4+,6-/m0/s1;   InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-N;   SMILES=Nc1nc(NC[C@H](O)[C@H](O)[C@H](O)COP(O)(O)=O)c(N)c(=O)[nH]1
 alt_id: CHEBI:52957
 xref: Beilstein:6443990 "Beilstein";   KEGG:C18910;   PMID:16730025 "Europe PMC"
 cyclic_relationship: is_conjugate_acid_of CHEBI:58890

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          nitrogen atom 0
            nitrogen molecular entity 0
              organonitrogen compound 0
                N-glycosyl compound 0
                  2,5-diamino-6-(5-phosphono)ribitylamino-4(3H)-pyrimidinone 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      chalcogen 0
                        oxygen atom 0
                          oxygen molecular entity 0
                            hydroxides 0
                              oxoacid 0
                                pnictogen oxoacid 0
                                  phosphorus oxoacid 0
                                    phosphoric acids 0
                                      phosphoric acid 0
                                        phosphoric acid derivative 0
                                          phosphate 0
                                            organic phosphate 0
                                              carbohydrate phosphate 0
                                                alditol phosphate 0
                                                  pentitol phosphate 0
                                                    ribitol phosphate 0
                                                      2,5-diamino-6-(5-phosphono)ribitylamino-4(3H)-pyrimidinone 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.