ONTOLOGY REPORT - ANNOTATIONS |
|
Term: | (4Z)-2,8:7,12:11,15:14,18:17,22-pentaanhydro-1,3-O-(2-carboxyethylidene)-4,5,6,9,10,13,19,20,21-nonadeoxy-L-arabino-L-allo-L-allo-docosa-4,9,20-trienitol |
|
Accession: | CHEBI:61274
|
browse the term
|
Definition: | A polycyclic ether comprising a linear sequence of sequence of six trans-fused six-, seven- and eight-membered oxacycles. |
Synonyms: | related_synonym: | Formula=C25H32O10; InChI=1S/C25H32O10/c26-21(27)11-22-30-12-20-14(34-22)6-3-5-13-15(32-20)7-8-16-18(31-13)10-19-25(35-16)23(28)24-17(33-19)4-1-2-9-29-24/h1-3,6-8,13-20,22-25,28H,4-5,9-12H2,(H,26,27)/b6-3-/t13-,14+,15+,16-,17+,18+,19-,20-,22?,23-,24+,25-/m1/s1; InChIKey=XIJLRYHHAQASDW-YARZGITESA-N; SMILES=[H][C@@]12COC(CC(O)=O)O[C@@]1([H])\\C=C/C[C@@]1([H])O[C@@]3([H])C[C@@]4([H])O[C@@]5([H])CC=CCO[C@]5([H])[C@@H](O)[C@]4([H])O[C@]3([H])C=C[C@]1([H])O2 |
| xref: | Reaxys:9453369 "Reaxys" |
|
|
Term paths to the root
Path 1 |
CHEBI ontology |
19716 |
 |
role |
19663 |
 |
biological role |
19661 |
 |
hapten |
2975 |
 |
(4Z)-2,8:7,12:11,15:14,18:17,22-pentaanhydro-1,3-O-(2-carboxyethylidene)-4,5,6,9,10,13,19,20,21-nonadeoxy-L-arabino-L-allo-L-allo-docosa-4,9,20-trienitol |
0 |
 |
Path 2 |
CHEBI ontology |
19716 |
 |
subatomic particle |
19712 |
 |
composite particle |
19712 |
 |
hadron |
19712 |
 |
baryon |
19712 |
 |
nucleon |
19712 |
 |
atomic nucleus |
19712 |
 |
atom |
19712 |
 |
main group element atom |
19598 |
 |
p-block element atom |
19598 |
 |
carbon group element atom |
19486 |
 |
carbon atom |
19480 |
 |
organic molecular entity |
19480 |
 |
heteroorganic entity |
19055 |
 |
organochalcogen compound |
18777 |
 |
organooxygen compound |
18689 |
 |
ether |
15765 |
 |
cyclic ether |
6418 |
 |
polycyclic ether |
1224 |
 |
(4Z)-2,8:7,12:11,15:14,18:17,22-pentaanhydro-1,3-O-(2-carboxyethylidene)-4,5,6,9,10,13,19,20,21-nonadeoxy-L-arabino-L-allo-L-allo-docosa-4,9,20-trienitol |
0 |
 |
| |
|