Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:15-deoxy-Delta(12,14)-prostaglandin A2
go back to main search page
Accession:CHEBI:63975 term browser browse the term
Definition:A prostaglandin A derivative that is prostaglandin A2 lacking the 15-hydroxy group and having C=C double bonds at positions 12(13) and 14(15).
Synonyms:exact_synonym: (5Z,12Z,14E)-9-oxoprosta-5,10,12,14-tetraen-1-oic acid
 related_synonym: 15-deoxy-PGA2;   15-deoxy-delta-12,14-PGA2;   15-deoxyprostaglandin A2;   15d-PGA2;   15d-prostaglandin A2;   9-oxo-5Z,10,12Z,14E-prostatetraenoic acid;   Formula=C20H28O3;   InChI=1S/C20H28O3/c1-2-3-4-5-6-9-12-17-15-16-19(21)18(17)13-10-7-8-11-14-20(22)23/h6-7,9-10,12,15-16,18H,2-5,8,11,13-14H2,1H3,(H,22,23)/b9-6+,10-7-,17-12-/t18-/m1/s1;   InChIKey=BHHHGDAJJMEHST-NBIYZLHXSA-N;   SMILES=CCCCC\\C=C\\C=C1\\C=CC(=O)[C@@H]1C\\C=C/CCCC(O)=O
 xref: LIPID_MAPS_instance:LMFA03010172 "LIPID MAPS";   Reaxys:2661205 "Reaxys"


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          carbon atom 0
            organic molecular entity 0
              olefinic compound 0
                enone 0
                  prostaglandins A 0
                    15-deoxy-Delta(12,14)-prostaglandin A2 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        monocarboxylic acid 0
                                          fatty acid 0
                                            fatty acid derivative 0
                                              icosanoid 0
                                                prostanoid 0
                                                  prostaglandin 0
                                                    prostaglandins A 0
                                                      prostaglandin A2 0
                                                        15-deoxy-Delta(12,14)-prostaglandin A2 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.