Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:3-methylthioaspartic acid
go back to main search page
Accession:CHEBI:73621 term browser browse the term
Definition:A sulfur-containing amino acid that is L-aspartic acid substituted at position 3 by a methylthio group.
Synonyms:exact_synonym: 3-(methylsulfanyl)-L-aspartic acid
 related_synonym: 3-(methylsulfanyl)aspartic acid;   3-(methylthio)-L-aspartic acid;   Formula=C5H9NO4S;   InChI=1S/C5H9NO4S/c1-11-3(5(9)10)2(6)4(7)8/h2-3H,6H2,1H3,(H,7,8)(H,9,10)/t2-,3?/m0/s1;   InChIKey=AOSGDBLMPHPJQU-SCQFTWEKSA-N;   SMILES=CSC([C@H](N)C(O)=O)C(O)=O
 xref: PMID:19736993 "Europe PMC";   PMID:20007320 "Europe PMC";   PMID:22174266 "Europe PMC";   Reaxys:18571117 "Reaxys"
 cyclic_relationship: is_conjugate_acid_of CHEBI:73620


GViewer not supported for chinchilla.
show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      group 0
        inorganic group 0
          thiol group 0
            thiol 0
              3-thio-L-aspartic acid 0
                3-methylthioaspartic acid 0
                  3-methylthioaspartic acid residue 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        amino acid 0
                                          alpha-amino acid 0
                                            L-alpha-amino acid 0
                                              aspartate family amino acid 0
                                                L-aspartic acid 0
                                                  L-aspartic acid derivative 0
                                                    3-thio-L-aspartic acid 0
                                                      3-methylthioaspartic acid 0
                                                        3-methylthioaspartic acid residue 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.