Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


Term:(allyl 7-azido-3,7-dideoxy-beta-L-gulo-oct-2-ulopyranosid)onic acid
go back to main search page
Accession:CHEBI:77882 term browser browse the term
Definition:The carbohydrate acid derivative that is the allyl glycoside of 7-azido-7-deoxy-7-epi-Kdo.
Synonyms:exact_synonym: (prop-2-en-1-yl 7-azido-3,7-dideoxy-beta-L-gulo-oct-2-ulopyranosid)onic acid
 related_synonym: 7-azido-7-epi-Kdo alpha-allyl glycoside;   Formula=C11H17N3O7;   InChI=1S/C11H17N3O7/c1-2-3-20-11(10(18)19)4-7(16)8(17)9(21-11)6(5-15)13-14-12/h2,6-9,15-17H,1,3-5H2,(H,18,19)/t6-,7+,8+,9+,11+/m0/s1;   InChIKey=DMIASQJQMANALE-UFFKNHFXSA-N;   SMILES=OC[C@H](N=[N+]=[N-])[C@H]1O[C@@](C[C@@H](O)[C@H]1O)(OCC=C)C(O)=O;   {prop-2-en-1-yl (6R)-6-[(1S)-1-azido-2-hydroxyethyl]-3-deoxy-beta-L-erythro-hex-2-ulopyranosid}onic acid
 xref: PMID:19665108
 cyclic_relationship: is_conjugate_acid_of CHEBI:77902

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19779
    chemical entity 19778
      atom 19777
        nonmetal atom 19651
          nitrogen atom 18458
            nitrogen molecular entity 18458
              azide 516
                (allyl 7-azido-3,7-dideoxy-beta-L-gulo-oct-2-ulopyranosid)onic acid 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19779
    subatomic particle 19777
      composite particle 19777
        hadron 19777
          baryon 19777
            nucleon 19777
              atomic nucleus 19777
                atom 19777
                  main group element atom 19664
                    p-block element atom 19664
                      carbon group element atom 19559
                        carbon atom 19548
                          organic molecular entity 19548
                            organic group 18463
                              organic divalent group 18456
                                organodiyl group 18456
                                  carbonyl group 18356
                                    carbonyl compound 18356
                                      carboxylic acid 18027
                                        carbohydrate acid 752
                                          ketoaldonic acid 623
                                            7-epi-Kdo 0
                                              (allyl 7-azido-3,7-dideoxy-beta-L-gulo-oct-2-ulopyranosid)onic acid 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.