Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:82627 term browser browse the term
Definition:A HPETE that is (5Z,8Z,11Z,13E,15R)-icosa-5,8,11,13-tetraenoic acid with the hydroperoxy group located at position 15 (the R-enantiomer).
Synonyms:related_synonym: (15R)-HPETE;   (5Z,8Z,11Z,13E,15R)-15-hydroperoxyeicosatetraenoic acid;   (5Z,8Z,11Z,13E,15R)-15-hydroperoxyicosa-5,8,11,13-tetraenoic acid;   (5Z,8Z,11Z,13E,15R)-15-hydroperoxyicosatetraenoic acid;   Formula=C20H32O4;   InChI=1S/C20H32O4/c1-2-3-13-16-19(24-23)17-14-11-9-7-5-4-6-8-10-12-15-18-20(21)22/h4-5,8-11,14,17,19,23H,2-3,6-7,12-13,15-16,18H2,1H3,(H,21,22)/b5-4-,10-8-,11-9-,17-14+/t19-/m1/s1;   InChIKey=BFWYTORDSFIVKP-UDQWCNDOSA-N;   SMILES=CCCCC[C@@H](OO)\\C=C\\C=C/C\\C=C/C\\C=C/CCCC(O)=O
 xref: MetaCyc:CPD-15850;   PMID:9048568;   Reaxys:5347290
 cyclic_relationship: is_conjugate_acid_of CHEBI:82626;   is_enantiomer_of CHEBI:15628

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          carbon atom 0
            organic molecular entity 0
              fatty acid derivative 0
                icosanoid 0
                  HPETE 0
                    15(R)-HPETE 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic group 0
                              organic divalent group 0
                                organodiyl group 0
                                  carbonyl group 0
                                    carbonyl compound 0
                                      carboxylic acid 0
                                        monocarboxylic acid 0
                                          fatty acid 0
                                            fatty acid derivative 0
                                              icosanoid 0
                                                HPETE 0
                                                  15(R)-HPETE 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.