Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:4-guanidinobutyric acid
go back to main search page
Accession:CHEBI:86564 term browser browse the term
Definition:A monocarboxylic acid that is butanoic acid substituted by a guanidino group at position 4.
Synonyms:exact_synonym: 4-carbamimidamidobutanoic acid
 related_synonym: 4-(diaminomethylideneamino)butanoic acid;   4-guanidinobutanoic acid;   Formula=C5H11N3O2;   InChI=1S/C5H11N3O2/c6-5(7)8-3-1-2-4(9)10/h1-3H2,(H,9,10)(H4,6,7,8);   InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N;   SMILES=NC(N)=NCCCC(O)=O
 xref: CAS:463-00-3 "ChemIDplus";   Reaxys:6717259 "Reaxys"


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19748
    chemical entity 19746
      atom 19744
        nonmetal atom 19616
          nitrogen atom 18402
            nitrogen molecular entity 18402
              organonitrogen compound 18194
                guanidines 1865
                  4-guanidinobutyric acid 0
                    4-[(E)-\{amino[(3-methylbut-2-en-1-yl)amino]methylidene\}amino]butanoic acid 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 19748
    subatomic particle 19744
      composite particle 19744
        hadron 19744
          baryon 19744
            nucleon 19744
              atomic nucleus 19744
                atom 19744
                  main group element atom 19628
                    p-block element atom 19628
                      carbon group element atom 19522
                        carbon atom 19516
                          organic molecular entity 19516
                            organic group 18426
                              organic divalent group 18418
                                organodiyl group 18418
                                  carbonyl group 18306
                                    carbonyl compound 18306
                                      carboxylic acid 17973
                                        monocarboxylic acid 17268
                                          4-guanidinobutyric acid 0
                                            4-[(E)-\{amino[(3-methylbut-2-en-1-yl)amino]methylidene\}amino]butanoic acid 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.